About [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate
[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 4877266) has the molecular formula C25H21N5O5
and a molecular weight of 471.47 g/mol. Its IUPAC name is [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
Molecular Properties
| Compound Name | [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| PubChem CID | 4877266 |
| Molecular Formula | C25H21N5O5 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)OCC(=O)c2c(-c3ccccc3)[nH]c3ccccc23)n(C)c1=O |
| InChI | InChI=1S/C25H21N5O5/c1-28-23-22(24(33)29(2)25(28)34)30(14-26-23)12-19(32)35-13-18(31)20-16-10-6-7-11-17(16)27-21(20)15-8-4-3-5-9-15/h3-11,14,27H,12-13H2,1-2H3 |
| InChIKey | UYIJSLNDXSAWHM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate?
The IUPAC name of [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (CID 4877266) is [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
What is the SMILES notation for [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate?
The canonical SMILES for [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate is Cn1c(=O)c2c(ncn2CC(=O)OCC(=O)c2c(-c3ccccc3)[nH]c3ccccc23)n(C)c1=O.
What is the InChIKey of [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate?
The InChIKey is UYIJSLNDXSAWHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N5O5/c1-28-23-22(24(33)29(2)25(28)34)30(14-26-23)12-19(32)35-13-18(31)20-16-10-6-7-11-17(16)27-21(20)15-8-4-3-5-9-15/h3-11,14,27H,12-13H2,1-2H3.
What are the key properties of [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate?
[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate has a molecular weight of 471.47 g/mol, XLogP of 2.01, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate is sourced from PubChem (CID 4877266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).