C25H21NO4 — CID 7599864
[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(2-methoxyphenyl)acetate (PubChem CID 7599864) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(2-methoxyphenyl)acetate.
| Compound Name | [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 7599864 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 2-(2-methoxyphenyl)acetate |
| SMILES | COc1ccccc1CC(=O)OCC(=O)c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C25H21NO4/c1-29-22-14-8-5-11-18(22)15-23(28)30-16-21(27)24-19-12-6-7-13-20(19)26-25(24)17-9-3-2-4-10-17/h2-14,26H,15-16H2,1H3 |
| InChIKey | TVWHUXALDRNDLM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |