C21H21NO4 — CID 7599860
[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-(2-methoxyphenyl)acetate (PubChem CID 7599860) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-(2-methoxyphenyl)acetate.
| Compound Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-(2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 7599860 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-(2-methoxyphenyl)acetate |
| SMILES | COc1ccccc1CC(=O)O[C@@H](C)C(=O)c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H21NO4/c1-13-20(16-9-5-6-10-17(16)22-13)21(24)14(2)26-19(23)12-15-8-4-7-11-18(15)25-3/h4-11,14,22H,12H2,1-3H3/t14-/m0/s1 |
| InChIKey | WPSDVGZIYPHCMT-AWEZNQCLSA-N |
| XLogP | 3.84 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |