C20H19NO4 — CID 7821861
[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] (2R)-2-hydroxy-2-phenylacetate (PubChem CID 7821861) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] (2R)-2-hydroxy-2-phenylacetate.
| Compound Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] (2R)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 7821861 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] (2R)-2-hydroxy-2-phenylacetate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@H](C)OC(=O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO4/c1-12-17(15-10-6-7-11-16(15)21-12)18(22)13(2)25-20(24)19(23)14-8-4-3-5-9-14/h3-11,13,19,21,23H,1-2H3/t13-,19+/m0/s1 |
| InChIKey | SOYFEIIEPGFJHB-ORAYPTAESA-N |
| XLogP | 3.32 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |