C26H21NO4 — CID 7865550
[(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-benzoylbenzoate (PubChem CID 7865550) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-benzoylbenzoate.
| Compound Name | [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 7865550 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-benzoylbenzoate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@@H](C)OC(=O)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H21NO4/c1-16-23(21-14-8-9-15-22(21)27-16)24(28)17(2)31-26(30)20-13-7-6-12-19(20)25(29)18-10-4-3-5-11-18/h3-15,17,27H,1-2H3/t17-/m1/s1 |
| InChIKey | IGFXMBLZUQETJL-QGZVFWFLSA-N |
| XLogP | 5.14 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |