C20H19NO5S — CID 18080330
[1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate (PubChem CID 18080330) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate.
| Compound Name | [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 18080330 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-methylsulfonylbenzoate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(C)OC(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C20H19NO5S/c1-12-18(14-8-4-6-10-16(14)21-12)19(22)13(2)26-20(23)15-9-5-7-11-17(15)27(3,24)25/h4-11,13,21H,1-3H3 |
| InChIKey | MFWNDWWPHGSZAB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |