C19H17ClN2O5S — CID 42983756
[1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 42983756) has the molecular formula C19H17ClN2O5S and a molecular weight of 420.87 g/mol. Its IUPAC name is [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 42983756 |
| Molecular Formula | C19H17ClN2O5S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(C)OC(=O)c1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C19H17ClN2O5S/c1-10-17(13-5-3-4-6-16(13)22-10)18(23)11(2)27-19(24)14-9-12(28(21,25)26)7-8-15(14)20/h3-9,11,22H,1-2H3,(H2,21,25,26) |
| InChIKey | GENVGNRGFOMFBW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 119.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |