C21H17NO4 — CID 7210590
[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate (PubChem CID 7210590) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate.
| Compound Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7210590 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@H](C)OC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H17NO4/c1-12-19(15-8-4-5-9-16(15)22-12)20(23)13(2)25-21(24)18-11-14-7-3-6-10-17(14)26-18/h3-11,13,22H,1-2H3/t13-/m0/s1 |
| InChIKey | VFUBDVBBPRUTKS-ZDUSSCGKSA-N |
| XLogP | 4.65 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |