C18H14Cl3N3O3 — CID 47006547
[1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 47006547) has the molecular formula C18H14Cl3N3O3 and a molecular weight of 426.69 g/mol. Its IUPAC name is [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 47006547 |
| Molecular Formula | C18H14Cl3N3O3 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(C)OC(=O)c1nc(Cl)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C18H14Cl3N3O3/c1-7-11(9-5-3-4-6-10(9)23-7)16(25)8(2)27-18(26)15-12(19)14(22)13(20)17(21)24-15/h3-6,8,23H,1-2H3,(H2,22,24) |
| InChIKey | HJVKSHJYYKZTHY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|