C17H15NO4 — CID 16540533
[1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] furan-2-carboxylate (PubChem CID 16540533) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] furan-2-carboxylate.
| Compound Name | [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 16540533 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] furan-2-carboxylate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(C)OC(=O)c1ccco1 |
| InChI | InChI=1S/C17H15NO4/c1-10-15(12-6-3-4-7-13(12)18-10)16(19)11(2)22-17(20)14-8-5-9-21-14/h3-9,11,18H,1-2H3 |
| InChIKey | JQGNFGPEOOZHDA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |