C19H16BrNO3 — CID 7889689
[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-bromobenzoate (PubChem CID 7889689) has the molecular formula C19H16BrNO3 and a molecular weight of 386.25 g/mol. Its IUPAC name is [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-bromobenzoate.
| Compound Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 7889689 |
| Molecular Formula | C19H16BrNO3 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-bromobenzoate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@H](C)OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H16BrNO3/c1-11-17(15-5-3-4-6-16(15)21-11)18(22)12(2)24-19(23)13-7-9-14(20)10-8-13/h3-10,12,21H,1-2H3/t12-/m0/s1 |
| InChIKey | QXQHCJASJZTUBQ-LBPRGKRZSA-N |
| XLogP | 4.67 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |