C20H16F3NO3 — CID 7859918
[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-(trifluoromethyl)benzoate (PubChem CID 7859918) has the molecular formula C20H16F3NO3 and a molecular weight of 375.35 g/mol. Its IUPAC name is [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7859918 |
| Molecular Formula | C20H16F3NO3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-(trifluoromethyl)benzoate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@H](C)OC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F3NO3/c1-11-17(15-5-3-4-6-16(15)24-11)18(25)12(2)27-19(26)13-7-9-14(10-8-13)20(21,22)23/h3-10,12,24H,1-2H3/t12-/m0/s1 |
| InChIKey | WUBGLDGJCUXPDZ-LBPRGKRZSA-N |
| XLogP | 4.92 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |