C19H15ClN2O5 — CID 7767983
[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-chloro-3-nitrobenzoate (PubChem CID 7767983) has the molecular formula C19H15ClN2O5 and a molecular weight of 386.79 g/mol. Its IUPAC name is [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-chloro-3-nitrobenzoate.
| Compound Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 7767983 |
| Molecular Formula | C19H15ClN2O5 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | [(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 4-chloro-3-nitrobenzoate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@H](C)OC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15ClN2O5/c1-10-17(13-5-3-4-6-15(13)21-10)18(23)11(2)27-19(24)12-7-8-14(20)16(9-12)22(25)26/h3-9,11,21H,1-2H3/t11-/m0/s1 |
| InChIKey | LVMRWLTZIGVHMJ-NSHDSACASA-N |
| XLogP | 4.47 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|