C20H17ClFNO3 — CID 7718329
[(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-(2-chloro-6-fluorophenyl)acetate (PubChem CID 7718329) has the molecular formula C20H17ClFNO3 and a molecular weight of 373.81 g/mol. Its IUPAC name is [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-(2-chloro-6-fluorophenyl)acetate.
| Compound Name | [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-(2-chloro-6-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7718329 |
| Molecular Formula | C20H17ClFNO3 |
| Molecular Weight | 373.81 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [(2R)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 2-(2-chloro-6-fluorophenyl)acetate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@@H](C)OC(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H17ClFNO3/c1-11-19(13-6-3-4-9-17(13)23-11)20(25)12(2)26-18(24)10-14-15(21)7-5-8-16(14)22/h3-9,12,23H,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | RZXFYXAWYNBNIK-GFCCVEGCSA-N |
| XLogP | 4.63 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.81 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |