C25H21NO3 — CID 7775436
[2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 4-ethylbenzoate (PubChem CID 7775436) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 4-ethylbenzoate.
| Compound Name | [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 7775436 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [2-oxo-2-(2-phenyl-1H-indol-3-yl)ethyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OCC(=O)c2c(-c3ccccc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H21NO3/c1-2-17-12-14-19(15-13-17)25(28)29-16-22(27)23-20-10-6-7-11-21(20)26-24(23)18-8-4-3-5-9-18/h3-15,26H,2,16H2,1H3 |
| InChIKey | SFTHDKRBHJXSRZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |