C15H14Cl2N2O3 — CID 86975448
(2,6-dichlorophenyl) 1-butyl-6-oxopyridazine-3-carboxylate (PubChem CID 86975448) has the molecular formula C15H14Cl2N2O3 and a molecular weight of 341.19 g/mol. Its IUPAC name is (2,6-dichlorophenyl) 1-butyl-6-oxopyridazine-3-carboxylate.
| Compound Name | (2,6-dichlorophenyl) 1-butyl-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 86975448 |
| Molecular Formula | C15H14Cl2N2O3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | (2,6-dichlorophenyl) 1-butyl-6-oxopyridazine-3-carboxylate |
| SMILES | CCCCn1nc(C(=O)Oc2c(Cl)cccc2Cl)ccc1=O |
| InChI | InChI=1S/C15H14Cl2N2O3/c1-2-3-9-19-13(20)8-7-12(18-19)15(21)22-14-10(16)5-4-6-11(14)17/h4-8H,2-3,9H2,1H3 |
| InChIKey | NSTDWISVQZGSJJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|