C19H19N3O5 — CID 30682303
2-(1,3-dioxoisoindol-2-yl)ethyl 1-butyl-6-oxopyridazine-3-carboxylate (PubChem CID 30682303) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 1-butyl-6-oxopyridazine-3-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 1-butyl-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 30682303 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 1-butyl-6-oxopyridazine-3-carboxylate |
| SMILES | CCCCn1nc(C(=O)OCCN2C(=O)c3ccccc3C2=O)ccc1=O |
| InChI | InChI=1S/C19H19N3O5/c1-2-3-10-22-16(23)9-8-15(20-22)19(26)27-12-11-21-17(24)13-6-4-5-7-14(13)18(21)25/h4-9H,2-3,10-12H2,1H3 |
| InChIKey | UGWBVEHURWSQON-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|