C19H22FN3O4 — CID 55400244
[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 1-butyl-6-oxopyridazine-3-carboxylate (PubChem CID 55400244) has the molecular formula C19H22FN3O4 and a molecular weight of 375.40 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 1-butyl-6-oxopyridazine-3-carboxylate.
| Compound Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 1-butyl-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 55400244 |
| Molecular Formula | C19H22FN3O4 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] 1-butyl-6-oxopyridazine-3-carboxylate |
| SMILES | CCCCn1nc(C(=O)OCC(=O)N(C)Cc2ccccc2F)ccc1=O |
| InChI | InChI=1S/C19H22FN3O4/c1-3-4-11-23-17(24)10-9-16(21-23)19(26)27-13-18(25)22(2)12-14-7-5-6-8-15(14)20/h5-10H,3-4,11-13H2,1-2H3 |
| InChIKey | IXONTGBOZXHWLB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |