C15H16Cl2N4O2 — CID 51266108
N-(4-amino-3,5-dichlorophenyl)-1-butyl-6-oxopyridazine-3-carboxamide (PubChem CID 51266108) has the molecular formula C15H16Cl2N4O2 and a molecular weight of 355.23 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-1-butyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-1-butyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 51266108 |
| Molecular Formula | C15H16Cl2N4O2 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-1-butyl-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)Nc2cc(Cl)c(N)c(Cl)c2)ccc1=O |
| InChI | InChI=1S/C15H16Cl2N4O2/c1-2-3-6-21-13(22)5-4-12(20-21)15(23)19-9-7-10(16)14(18)11(17)8-9/h4-5,7-8H,2-3,6,18H2,1H3,(H,19,23) |
| InChIKey | FTGCAGGSAPAEID-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|