C15H15ClIN3O2 — CID 55677510
1-butyl-N-(2-chloro-4-iodophenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 55677510) has the molecular formula C15H15ClIN3O2 and a molecular weight of 431.66 g/mol. Its IUPAC name is 1-butyl-N-(2-chloro-4-iodophenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-butyl-N-(2-chloro-4-iodophenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55677510 |
| Molecular Formula | C15H15ClIN3O2 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | 1-butyl-N-(2-chloro-4-iodophenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)Nc2ccc(I)cc2Cl)ccc1=O |
| InChI | InChI=1S/C15H15ClIN3O2/c1-2-3-8-20-14(21)7-6-13(19-20)15(22)18-12-5-4-10(17)9-11(12)16/h4-7,9H,2-3,8H2,1H3,(H,18,22) |
| InChIKey | CXSYQWZMQSDEBR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|