C15H15F2N3O2 — CID 42161973
1-butyl-N-(3,4-difluorophenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 42161973) has the molecular formula C15H15F2N3O2 and a molecular weight of 307.30 g/mol. Its IUPAC name is 1-butyl-N-(3,4-difluorophenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-butyl-N-(3,4-difluorophenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 42161973 |
| Molecular Formula | C15H15F2N3O2 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-butyl-N-(3,4-difluorophenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)Nc2ccc(F)c(F)c2)ccc1=O |
| InChI | InChI=1S/C15H15F2N3O2/c1-2-3-8-20-14(21)7-6-13(19-20)15(22)18-10-4-5-11(16)12(17)9-10/h4-7,9H,2-3,8H2,1H3,(H,18,22) |
| InChIKey | FPZDYKVKHBQDNU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |