C24H26N4O5S — CID 27428687
6-oxo-1-(2-phenoxyethyl)-N-(3-piperidin-1-ylsulfonylphenyl)pyridazine-3-carboxamide (PubChem CID 27428687) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is 6-oxo-1-(2-phenoxyethyl)-N-(3-piperidin-1-ylsulfonylphenyl)pyridazine-3-carboxamide.
| Compound Name | 6-oxo-1-(2-phenoxyethyl)-N-(3-piperidin-1-ylsulfonylphenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 27428687 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 6-oxo-1-(2-phenoxyethyl)-N-(3-piperidin-1-ylsulfonylphenyl)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCCC2)c1)c1ccc(=O)n(CCOc2ccccc2)n1 |
| InChI | InChI=1S/C24H26N4O5S/c29-23-13-12-22(26-28(23)16-17-33-20-9-3-1-4-10-20)24(30)25-19-8-7-11-21(18-19)34(31,32)27-14-5-2-6-15-27/h1,3-4,7-13,18H,2,5-6,14-17H2,(H,25,30) |
| InChIKey | WOOSEFXNAIPFLY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |