C24H33N3O4S — CID 55680404
2-[methyl(3-phenoxypropyl)amino]-N-(3-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 55680404) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is 2-[methyl(3-phenoxypropyl)amino]-N-(3-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 2-[methyl(3-phenoxypropyl)amino]-N-(3-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55680404 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-[methyl(3-phenoxypropyl)amino]-N-(3-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CC(C(=O)Nc1cccc(S(=O)(=O)N2CCCCC2)c1)N(C)CCCOc1ccccc1 |
| InChI | InChI=1S/C24H33N3O4S/c1-20(26(2)15-10-18-31-22-12-5-3-6-13-22)24(28)25-21-11-9-14-23(19-21)32(29,30)27-16-7-4-8-17-27/h3,5-6,9,11-14,19-20H,4,7-8,10,15-18H2,1-2H3,(H,25,28) |
| InChIKey | FYRSADZDAJESDQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|