C16H23N3O5S — CID 119911319
3-[methyl-[2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl]amino]propanoic acid (PubChem CID 119911319) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is 3-[methyl-[2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119911319 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 3-[methyl-[2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl]amino]propanoic acid |
| SMILES | CN(CCC(=O)O)CC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C16H23N3O5S/c1-18(10-7-16(21)22)12-15(20)17-13-5-4-6-14(11-13)25(23,24)19-8-2-3-9-19/h4-6,11H,2-3,7-10,12H2,1H3,(H,17,20)(H,21,22) |
| InChIKey | ZJFGKZIBEUBTHO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |