C22H27N3O6S2 — CID 4845327
2-[(4-acetylphenyl)sulfonyl-methylamino]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 4845327) has the molecular formula C22H27N3O6S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 2-[(4-acetylphenyl)sulfonyl-methylamino]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(4-acetylphenyl)sulfonyl-methylamino]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 4845327 |
| Molecular Formula | C22H27N3O6S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-[(4-acetylphenyl)sulfonyl-methylamino]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(C)CC(=O)Nc2cccc(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C22H27N3O6S2/c1-17(26)18-9-11-20(12-10-18)32(28,29)24(2)16-22(27)23-19-7-6-8-21(15-19)33(30,31)25-13-4-3-5-14-25/h6-12,15H,3-5,13-14,16H2,1-2H3,(H,23,27) |
| InChIKey | DKHSQZCFYOOGBR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |