C23H23ClN4O4 — CID 24603947
N-(3-chloro-2-morpholin-4-ylphenyl)-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide (PubChem CID 24603947) has the molecular formula C23H23ClN4O4 and a molecular weight of 454.91 g/mol. Its IUPAC name is N-(3-chloro-2-morpholin-4-ylphenyl)-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide.
| Compound Name | N-(3-chloro-2-morpholin-4-ylphenyl)-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 24603947 |
| Molecular Formula | C23H23ClN4O4 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N-(3-chloro-2-morpholin-4-ylphenyl)-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1N1CCOCC1)c1ccc(=O)n(CCOc2ccccc2)n1 |
| InChI | InChI=1S/C23H23ClN4O4/c24-18-7-4-8-19(22(18)27-11-14-31-15-12-27)25-23(30)20-9-10-21(29)28(26-20)13-16-32-17-5-2-1-3-6-17/h1-10H,11-16H2,(H,25,30) |
| InChIKey | IKVUGNXCWVANEZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |