C21H22N4O5S — CID 55985605
N-[2-(dimethylsulfamoyl)phenyl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide (PubChem CID 55985605) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)phenyl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide.
| Compound Name | N-[2-(dimethylsulfamoyl)phenyl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55985605 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)phenyl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1NC(=O)c1ccc(=O)n(CCOc2ccccc2)n1 |
| InChI | InChI=1S/C21H22N4O5S/c1-24(2)31(28,29)19-11-7-6-10-17(19)22-21(27)18-12-13-20(26)25(23-18)14-15-30-16-8-4-3-5-9-16/h3-13H,14-15H2,1-2H3,(H,22,27) |
| InChIKey | AOGOFPDVYXRHIR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |