C23H24N4O5 — CID 34870934
N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide (PubChem CID 34870934) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide.
| Compound Name | N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 34870934 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide |
| SMILES | CCNC(=O)COc1cccc(NC(=O)c2ccc(=O)n(CCOc3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H24N4O5/c1-2-24-21(28)16-32-19-10-6-7-17(15-19)25-23(30)20-11-12-22(29)27(26-20)13-14-31-18-8-4-3-5-9-18/h3-12,15H,2,13-14,16H2,1H3,(H,24,28)(H,25,30) |
| InChIKey | FLFGQQMSTHATJK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |