C15H15ClN4O4 — CID 18081052
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate (PubChem CID 18081052) has the molecular formula C15H15ClN4O4 and a molecular weight of 350.76 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate |
|---|---|
| PubChem CID | 18081052 |
| Molecular Formula | C15H15ClN4O4 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate |
| SMILES | CCCn1nc(C(=O)OCC(=O)Nc2ccc(Cl)cn2)ccc1=O |
| InChI | InChI=1S/C15H15ClN4O4/c1-2-7-20-14(22)6-4-11(19-20)15(23)24-9-13(21)18-12-5-3-10(16)8-17-12/h3-6,8H,2,7,9H2,1H3,(H,17,18,21) |
| InChIKey | HEXOKTXURAJWCO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |