C27H26N4O3 — CID 46638259
[2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 4-cyanobenzoate (PubChem CID 46638259) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is [2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 46638259 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl] 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)OCC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H26N4O3/c28-18-21-6-8-23(9-7-21)27(33)34-20-26(32)29-24-10-12-25(13-11-24)31-16-14-30(15-17-31)19-22-4-2-1-3-5-22/h1-13H,14-17,19-20H2,(H,29,32) |
| InChIKey | OVOCYUZWTTZWTG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|