C28H38N6O2 — CID 55462140
2-[4-[2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl]piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 55462140) has the molecular formula C28H38N6O2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 2-[4-[2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl]piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl]piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55462140 |
| Molecular Formula | C28H38N6O2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 2-[4-[2-[4-(4-benzylpiperazin-1-yl)anilino]-2-oxoethyl]piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(CC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C28H38N6O2/c1-2-12-29-27(35)22-32-13-15-33(16-14-32)23-28(36)30-25-8-10-26(11-9-25)34-19-17-31(18-20-34)21-24-6-4-3-5-7-24/h2-11H,1,12-23H2,(H,29,35)(H,30,36) |
| InChIKey | LWRIFLLOPFXHEI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|