C18H25N3O3 — CID 46516315
methyl 4-[[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]methyl]benzoate (PubChem CID 46516315) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is methyl 4-[[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 46516315 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | methyl 4-[[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]methyl]benzoate |
| SMILES | C=CCNC(=O)CN1CCN(Cc2ccc(C(=O)OC)cc2)CC1 |
| InChI | InChI=1S/C18H25N3O3/c1-3-8-19-17(22)14-21-11-9-20(10-12-21)13-15-4-6-16(7-5-15)18(23)24-2/h3-7H,1,8-14H2,2H3,(H,19,22) |
| InChIKey | XCTMZESSVVDVCA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|