C17H23ClN3O3- — CID 53351912
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-prop-2-enylacetamide chloride (PubChem CID 53351912) has the molecular formula C17H23ClN3O3- and a molecular weight of 352.84 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-prop-2-enylacetamide chloride.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-prop-2-enylacetamide chloride |
|---|---|
| PubChem CID | 53351912 |
| Molecular Formula | C17H23ClN3O3- |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-prop-2-enylacetamide chloride |
| SMILES | C=CCNC(=O)CN1CCN(Cc2ccc3c(c2)OCO3)CC1.[Cl-] |
| InChI | InChI=1S/C17H23N3O3.ClH/c1-2-5-18-17(21)12-20-8-6-19(7-9-20)11-14-3-4-15-16(10-14)23-13-22-15;/h2-4,10H,1,5-9,11-13H2,(H,18,21);1H/p-1 |
| InChIKey | WEQPLSGEBSHZLF-UHFFFAOYSA-M |
| XLogP | -2.16 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|