C25H29N3O8 — CID 17413436
N-(1,3-benzodioxol-5-ylmethyl)-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]acetamide;oxalic acid (PubChem CID 17413436) has the molecular formula C25H29N3O8 and a molecular weight of 499.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]acetamide;oxalic acid.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 17413436 |
| Molecular Formula | C25H29N3O8 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]acetamide;oxalic acid |
| SMILES | O=C(CN1CCN(Cc2ccc3c(c2)CCO3)CC1)NCc1ccc2c(c1)OCO2.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H27N3O4.C2H2O4/c27-23(24-13-17-1-4-21-22(12-17)30-16-29-21)15-26-8-6-25(7-9-26)14-18-2-3-20-19(11-18)5-10-28-20;3-1(4)2(5)6/h1-4,11-12H,5-10,13-16H2,(H,24,27);(H,3,4)(H,5,6) |
| InChIKey | YHMAXDCQMCVJBO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|