C27H29N3O3 — CID 2812559
2-(4-benzhydrylpiperazin-1-yl)-N-(1,3-benzodioxol-5-ylmethyl)acetamide (PubChem CID 2812559) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)-N-(1,3-benzodioxol-5-ylmethyl)acetamide.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)-N-(1,3-benzodioxol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 2812559 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)-N-(1,3-benzodioxol-5-ylmethyl)acetamide |
| SMILES | O=C(CN1CCN(C(c2ccccc2)c2ccccc2)CC1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H29N3O3/c31-26(28-18-21-11-12-24-25(17-21)33-20-32-24)19-29-13-15-30(16-14-29)27(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-12,17,27H,13-16,18-20H2,(H,28,31) |
| InChIKey | QMPKOGJYDLSOBL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |