C21H25N3O3 — CID 113107192
N-(1,3-benzodioxol-5-ylmethyl)-4-(1-phenylethyl)piperazine-1-carboxamide (PubChem CID 113107192) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-(1-phenylethyl)piperazine-1-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(1-phenylethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113107192 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(1-phenylethyl)piperazine-1-carboxamide |
| SMILES | CC(c1ccccc1)N1CCN(C(=O)NCc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C21H25N3O3/c1-16(18-5-3-2-4-6-18)23-9-11-24(12-10-23)21(25)22-14-17-7-8-19-20(13-17)27-15-26-19/h2-8,13,16H,9-12,14-15H2,1H3,(H,22,25) |
| InChIKey | OPPCLLLZHICRJY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |