C24H33N3O3 — CID 8531597
N-(1-adamantyl)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]acetamide (PubChem CID 8531597) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8531597 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | N-(1-adamantyl)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccc3c(c2)OCO3)CC1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H33N3O3/c28-23(25-24-11-18-7-19(12-24)9-20(8-18)13-24)15-27-5-3-26(4-6-27)14-17-1-2-21-22(10-17)30-16-29-21/h1-2,10,18-20H,3-9,11-16H2,(H,25,28) |
| InChIKey | PZQRAWPRRVEGBB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |