C16H22N2O4 — CID 791345
ethyl 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]acetate (PubChem CID 791345) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is ethyl 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 791345 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | ethyl 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C16H22N2O4/c1-2-20-16(19)11-18-7-5-17(6-8-18)10-13-3-4-14-15(9-13)22-12-21-14/h3-4,9H,2,5-8,10-12H2,1H3 |
| InChIKey | OZPZFOMKSSJRHH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |