C27H44N4O6 — CID 14031656
ethyl 2-[4-benzyl-7,10-bis(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 14031656) has the molecular formula C27H44N4O6 and a molecular weight of 520.67 g/mol. Its IUPAC name is ethyl 2-[4-benzyl-7,10-bis(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | ethyl 2-[4-benzyl-7,10-bis(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 14031656 |
| Molecular Formula | C27H44N4O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | ethyl 2-[4-benzyl-7,10-bis(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(CC(=O)OCC)CCN(Cc2ccccc2)CCN(CC(=O)OCC)CC1 |
| InChI | InChI=1S/C27H44N4O6/c1-4-35-25(32)21-29-14-12-28(20-24-10-8-7-9-11-24)13-15-30(22-26(33)36-5-2)17-19-31(18-16-29)23-27(34)37-6-3/h7-11H,4-6,12-23H2,1-3H3 |
| InChIKey | SAIVDPREQHWCSE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 91.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|