C24H27N5O — CID 57188143
2-[4-(4-aminophenyl)piperazin-1-yl]-N-(4-anilinophenyl)acetamide (PubChem CID 57188143) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-[4-(4-aminophenyl)piperazin-1-yl]-N-(4-anilinophenyl)acetamide.
| Compound Name | 2-[4-(4-aminophenyl)piperazin-1-yl]-N-(4-anilinophenyl)acetamide |
|---|---|
| PubChem CID | 57188143 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-[4-(4-aminophenyl)piperazin-1-yl]-N-(4-anilinophenyl)acetamide |
| SMILES | Nc1ccc(N2CCN(CC(=O)Nc3ccc(Nc4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H27N5O/c25-19-6-12-23(13-7-19)29-16-14-28(15-17-29)18-24(30)27-22-10-8-21(9-11-22)26-20-4-2-1-3-5-20/h1-13,26H,14-18,25H2,(H,27,30) |
| InChIKey | KJBQCQZZTFYAMJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|