C23H29N3O3 — CID 17475542
4-tert-butyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]benzamide (PubChem CID 17475542) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 17475542 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 4-tert-butyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCC(=O)Nc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-23(2,3)18-6-4-17(5-7-18)22(28)24-16-21(27)25-19-8-10-20(11-9-19)26-12-14-29-15-13-26/h4-11H,12-16H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | YDIAQTDPISBCBP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|