C21H24N4O2S — CID 24665733
2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 24665733) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 24665733 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | Cc1cc(NC(=O)Cc2csc(-c3ccco3)n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C21H24N4O2S/c1-15-12-16(5-6-18(15)25-9-7-24(2)8-10-25)22-20(26)13-17-14-28-21(23-17)19-4-3-11-27-19/h3-6,11-12,14H,7-10,13H2,1-2H3,(H,22,26) |
| InChIKey | VMBUMRTZMAUCKL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|