C23H14ClN3O4S — CID 55726196
N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide (PubChem CID 55726196) has the molecular formula C23H14ClN3O4S and a molecular weight of 463.90 g/mol. Its IUPAC name is N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 55726196 |
| Molecular Formula | C23H14ClN3O4S |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1csc(-c2ccco2)n1)Nc1ccc(N2C(=O)c3ccccc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C23H14ClN3O4S/c24-17-10-13(25-20(28)11-14-12-32-21(26-14)19-6-3-9-31-19)7-8-18(17)27-22(29)15-4-1-2-5-16(15)23(27)30/h1-10,12H,11H2,(H,25,28) |
| InChIKey | NDVUEJPDLDVGQD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|