C25H19ClN2O3 — CID 55778666
N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-2-(2,3-dihydro-1H-inden-5-yl)acetamide (PubChem CID 55778666) has the molecular formula C25H19ClN2O3 and a molecular weight of 430.89 g/mol. Its IUPAC name is N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-2-(2,3-dihydro-1H-inden-5-yl)acetamide.
| Compound Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-2-(2,3-dihydro-1H-inden-5-yl)acetamide |
|---|---|
| PubChem CID | 55778666 |
| Molecular Formula | C25H19ClN2O3 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-2-(2,3-dihydro-1H-inden-5-yl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)CCC2)Nc1ccc(N2C(=O)c3ccccc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C25H19ClN2O3/c26-21-14-18(27-23(29)13-15-8-9-16-4-3-5-17(16)12-15)10-11-22(21)28-24(30)19-6-1-2-7-20(19)25(28)31/h1-2,6-12,14H,3-5,13H2,(H,27,29) |
| InChIKey | HZKFACFAQXWYLV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|