C20H13ClN2O6S — CID 122193167
N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-5-methylsulfonylfuran-2-carboxamide (PubChem CID 122193167) has the molecular formula C20H13ClN2O6S and a molecular weight of 444.85 g/mol. Its IUPAC name is N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-5-methylsulfonylfuran-2-carboxamide.
| Compound Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-5-methylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 122193167 |
| Molecular Formula | C20H13ClN2O6S |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-5-methylsulfonylfuran-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(N3C(=O)c4ccccc4C3=O)c(Cl)c2)o1 |
| InChI | InChI=1S/C20H13ClN2O6S/c1-30(27,28)17-9-8-16(29-17)18(24)22-11-6-7-15(14(21)10-11)23-19(25)12-4-2-3-5-13(12)20(23)26/h2-10H,1H3,(H,22,24) |
| InChIKey | JMFPGGHGRTUWNT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|