C25H15ClN2O4 — CID 122193169
N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenylfuran-2-carboxamide (PubChem CID 122193169) has the molecular formula C25H15ClN2O4 and a molecular weight of 442.86 g/mol. Its IUPAC name is N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenylfuran-2-carboxamide.
| Compound Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 122193169 |
| Molecular Formula | C25H15ClN2O4 |
| Molecular Weight | 442.86 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenylfuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2C(=O)c3ccccc3C2=O)c(Cl)c1)c1occc1-c1ccccc1 |
| InChI | InChI=1S/C25H15ClN2O4/c26-20-14-16(27-23(29)22-17(12-13-32-22)15-6-2-1-3-7-15)10-11-21(20)28-24(30)18-8-4-5-9-19(18)25(28)31/h1-14H,(H,27,29) |
| InChIKey | GHPUZYKAMFPMRE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.86 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|