C19H9Cl3N2O3S — CID 55778635
2,5-dichloro-N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]thiophene-3-carboxamide (PubChem CID 55778635) has the molecular formula C19H9Cl3N2O3S and a molecular weight of 451.72 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 55778635 |
| Molecular Formula | C19H9Cl3N2O3S |
| Molecular Weight | 451.72 g/mol |
| Exact Mass | 449.94 |
| IUPAC Name | 2,5-dichloro-N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2C(=O)c3ccccc3C2=O)c(Cl)c1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C19H9Cl3N2O3S/c20-13-7-9(23-17(25)12-8-15(21)28-16(12)22)5-6-14(13)24-18(26)10-3-1-2-4-11(10)19(24)27/h1-8H,(H,23,25) |
| InChIKey | BSBTVOKWTBIELZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.72 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|