C22H14Cl2N2O3 — CID 1335673
2-chloro-N-(3-chloro-4-methylphenyl)-5-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 1335673) has the molecular formula C22H14Cl2N2O3 and a molecular weight of 425.27 g/mol. Its IUPAC name is 2-chloro-N-(3-chloro-4-methylphenyl)-5-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | 2-chloro-N-(3-chloro-4-methylphenyl)-5-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 1335673 |
| Molecular Formula | C22H14Cl2N2O3 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 2-chloro-N-(3-chloro-4-methylphenyl)-5-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(N3C(=O)c4ccccc4C3=O)ccc2Cl)cc1Cl |
| InChI | InChI=1S/C22H14Cl2N2O3/c1-12-6-7-13(10-19(12)24)25-20(27)17-11-14(8-9-18(17)23)26-21(28)15-4-2-3-5-16(15)22(26)29/h2-11H,1H3,(H,25,27) |
| InChIKey | YDRHLNZKTMEQMK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|