C18H11ClN2O3 — CID 176547430
N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]buta-2,3-dienamide (PubChem CID 176547430) has the molecular formula C18H11ClN2O3 and a molecular weight of 338.75 g/mol. Its IUPAC name is N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]buta-2,3-dienamide.
| Compound Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 176547430 |
| Molecular Formula | C18H11ClN2O3 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)Nc1ccc(N2C(=O)c3ccccc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C18H11ClN2O3/c1-2-5-16(22)20-11-8-9-15(14(19)10-11)21-17(23)12-6-3-4-7-13(12)18(21)24/h3-10H,1H2,(H,20,22) |
| InChIKey | GDTGFSXQGGQNTQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|