C20H12ClN3O5S — CID 55778627
N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-5-methyl-4-nitrothiophene-2-carboxamide (PubChem CID 55778627) has the molecular formula C20H12ClN3O5S and a molecular weight of 441.85 g/mol. Its IUPAC name is N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-5-methyl-4-nitrothiophene-2-carboxamide.
| Compound Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-5-methyl-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55778627 |
| Molecular Formula | C20H12ClN3O5S |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-5-methyl-4-nitrothiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)Nc2ccc(N3C(=O)c4ccccc4C3=O)c(Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H12ClN3O5S/c1-10-16(24(28)29)9-17(30-10)18(25)22-11-6-7-15(14(21)8-11)23-19(26)12-4-2-3-5-13(12)20(23)27/h2-9H,1H3,(H,22,25) |
| InChIKey | ABHSKGRBVITXOH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|